C20H15FN2O3 — CID 170297085
(3S)-1-[3-(8-fluoroquinolin-3-yl)phenyl]-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 170297085) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is (3S)-1-[3-(8-fluoroquinolin-3-yl)phenyl]-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-[3-(8-fluoroquinolin-3-yl)phenyl]-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 170297085 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (3S)-1-[3-(8-fluoroquinolin-3-yl)phenyl]-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN(c2cccc(-c3cnc4c(F)cccc4c3)c2)C1=O |
| InChI | InChI=1S/C20H15FN2O3/c21-17-6-2-4-13-9-14(11-22-18(13)17)12-3-1-5-15(10-12)23-8-7-16(19(23)24)20(25)26/h1-6,9-11,16H,7-8H2,(H,25,26)/t16-/m0/s1 |
| InChIKey | KAVJNFYRZBYHJH-INIZCTEOSA-N |
| XLogP | 3.48 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|