About pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate
pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate (PubChem CID 170298047) has the molecular formula C35H69NO4
and a molecular weight of 567.94 g/mol. Its IUPAC name is pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate.
Molecular Properties
| Compound Name | pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate |
| PubChem CID | 170298047 |
| Molecular Formula | C35H69NO4 |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 567.52 |
| IUPAC Name | pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CN(C)CC(=O)OC(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C35H69NO4/c1-6-10-14-18-22-26-32(27-23-19-15-11-7-2)39-34(37)30-36(5)31-35(38)40-33(28-24-20-16-12-8-3)29-25-21-17-13-9-4/h32-33H,6-31H2,1-5H3 |
| InChIKey | IQZKFOCLUUGUSO-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate?
The IUPAC name of pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate (CID 170298047) is pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate.
What is the SMILES notation for pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate?
The canonical SMILES for pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate is CCCCCCCC(CCCCCCC)OC(=O)CN(C)CC(=O)OC(CCCCCCC)CCCCCCC.
What is the InChIKey of pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate?
The InChIKey is IQZKFOCLUUGUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H69NO4/c1-6-10-14-18-22-26-32(27-23-19-15-11-7-2)39-34(37)30-36(5)31-35(38)40-33(28-24-20-16-12-8-3)29-25-21-17-13-9-4/h32-33H,6-31H2,1-5H3.
What are the key properties of pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate?
pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate has a molecular weight of 567.94 g/mol, XLogP of 10.18, 30 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecan-8-yl 2-[methyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate is sourced from PubChem (CID 170298047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).