C27H34ClF3N4O3 — CID 170308600
[(7S,9aR)-7-[(4-chlorophenyl)methyl]-8-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 170308600) has the molecular formula C27H34ClF3N4O3 and a molecular weight of 555.04 g/mol. Its IUPAC name is [(7S,9aR)-7-[(4-chlorophenyl)methyl]-8-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(7S,9aR)-7-[(4-chlorophenyl)methyl]-8-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170308600 |
| Molecular Formula | C27H34ClF3N4O3 |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | [(7S,9aR)-7-[(4-chlorophenyl)methyl]-8-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(C2CCC(N3C[C@@H]4C(OC(=O)C(F)(F)F)OCCN4C[C@@H]3Cc3ccc(Cl)cc3)CC2)nn1C |
| InChI | InChI=1S/C27H34ClF3N4O3/c1-17-13-23(32-33(17)2)19-5-9-21(10-6-19)35-16-24-25(38-26(36)27(29,30)31)37-12-11-34(24)15-22(35)14-18-3-7-20(28)8-4-18/h3-4,7-8,13,19,21-22,24-25H,5-6,9-12,14-16H2,1-2H3/t19?,21?,22-,24+,25?/m0/s1 |
| InChIKey | NNFXWOIINKAMPQ-VJQHWGIBSA-N |
| XLogP | 4.47 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |