C27H36ClF3N4O4 — CID 170308675
(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-ethylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 170308675) has the molecular formula C27H36ClF3N4O4 and a molecular weight of 573.06 g/mol. Its IUPAC name is (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-ethylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-ethylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170308675 |
| Molecular Formula | C27H36ClF3N4O4 |
| Molecular Weight | 573.06 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-ethylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCNC(=O)[C@H]1CN(C2CCC(c3cc(C)n(C)n3)CC2)[C@@H](Cc2ccc(Cl)cc2)CO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H35ClN4O2.C2HF3O2/c1-4-27-25(31)24-15-30(22(16-32-24)14-18-5-9-20(26)10-6-18)21-11-7-19(8-12-21)23-13-17(2)29(3)28-23;3-2(4,5)1(6)7/h5-6,9-10,13,19,21-22,24H,4,7-8,11-12,14-16H2,1-3H3,(H,27,31);(H,6,7)/t19?,21?,22-,24+;/m0./s1 |
| InChIKey | KFEHQMRODFUGDI-FXHZXLKNSA-N |
| XLogP | 4.49 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |