C28H37Cl2N5O2S — CID 169321123
(2R,5S)-5-[(4-chlorophenyl)methyl]-N-(1,5-dimethylpyrazol-3-yl)-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 169321123) has the molecular formula C28H37Cl2N5O2S and a molecular weight of 578.61 g/mol. Its IUPAC name is (2R,5S)-5-[(4-chlorophenyl)methyl]-N-(1,5-dimethylpyrazol-3-yl)-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-N-(1,5-dimethylpyrazol-3-yl)-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 169321123 |
| Molecular Formula | C28H37Cl2N5O2S |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-N-(1,5-dimethylpyrazol-3-yl)-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | Cc1nc(C2CCC(N3C[C@H](C(=O)Nc4cc(C)n(C)n4)OC[C@@H]3Cc3ccc(Cl)cc3)CC2)sc1C.Cl |
| InChI | InChI=1S/C28H36ClN5O2S.ClH/c1-17-13-26(32-33(17)4)31-27(35)25-15-34(24(16-36-25)14-20-5-9-22(29)10-6-20)23-11-7-21(8-12-23)28-30-18(2)19(3)37-28;/h5-6,9-10,13,21,23-25H,7-8,11-12,14-16H2,1-4H3,(H,31,32,35);1H/t21?,23?,24-,25+;/m0./s1 |
| InChIKey | OIAOCGMFUMZHQG-SJMAYMTJSA-N |
| XLogP | 5.85 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |