C28H42ClN5O3S — CID 170360958
ethyl 2-[amino-[2-amino-2-[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethyl]amino]acetate (PubChem CID 170360958) has the molecular formula C28H42ClN5O3S and a molecular weight of 564.20 g/mol. Its IUPAC name is ethyl 2-[amino-[2-amino-2-[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethyl]amino]acetate.
| Compound Name | ethyl 2-[amino-[2-amino-2-[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethyl]amino]acetate |
|---|---|
| PubChem CID | 170360958 |
| Molecular Formula | C28H42ClN5O3S |
| Molecular Weight | 564.20 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | ethyl 2-[amino-[2-amino-2-[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(N)CC(N)[C@H]1CN(C2CCC(c3nc(C)c(C)s3)CC2)[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C28H42ClN5O3S/c1-4-36-27(35)16-33(31)14-25(30)26-15-34(24(17-37-26)13-20-5-9-22(29)10-6-20)23-11-7-21(8-12-23)28-32-18(2)19(3)38-28/h5-6,9-10,21,23-26H,4,7-8,11-17,30-31H2,1-3H3/t21?,23?,24-,25?,26+/m0/s1 |
| InChIKey | CISBAEQHKJJOEC-IOMYTNPNSA-N |
| XLogP | 3.82 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|