C27H38ClN5O3S — CID 170356219
3-[amino-[(Z)-2-amino-2-[5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethenyl]amino]propanoic acid (PubChem CID 170356219) has the molecular formula C27H38ClN5O3S and a molecular weight of 548.15 g/mol. Its IUPAC name is 3-[amino-[(Z)-2-amino-2-[5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethenyl]amino]propanoic acid.
| Compound Name | 3-[amino-[(Z)-2-amino-2-[5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethenyl]amino]propanoic acid |
|---|---|
| PubChem CID | 170356219 |
| Molecular Formula | C27H38ClN5O3S |
| Molecular Weight | 548.15 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 3-[amino-[(Z)-2-amino-2-[5-[(4-chlorophenyl)methyl]-4-[4-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexyl]morpholin-2-yl]ethenyl]amino]propanoic acid |
| SMILES | Cc1nc(C2CCC(N3CC(/C(N)=C/N(N)CCC(=O)O)OCC3Cc3ccc(Cl)cc3)CC2)sc1C |
| InChI | InChI=1S/C27H38ClN5O3S/c1-17-18(2)37-27(31-17)20-5-9-22(10-6-20)33-15-25(24(29)14-32(30)12-11-26(34)35)36-16-23(33)13-19-3-7-21(28)8-4-19/h3-4,7-8,14,20,22-23,25H,5-6,9-13,15-16,29-30H2,1-2H3,(H,34,35)/b24-14- |
| InChIKey | IQYJSVLSIVLZMY-OYKKKHCWSA-N |
| XLogP | 4.20 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.15 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|