C41H51ClN6O5 — CID 170357925
5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-[5-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]pentyl]morpholine-2-carboxamide (PubChem CID 170357925) has the molecular formula C41H51ClN6O5 and a molecular weight of 743.35 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-[5-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]pentyl]morpholine-2-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-[5-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]pentyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 170357925 |
| Molecular Formula | C41H51ClN6O5 |
| Molecular Weight | 743.35 g/mol |
| Exact Mass | 742.36 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]-N-[5-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]pentyl]morpholine-2-carboxamide |
| SMILES | Cc1cc(C2CCC(N3CC(C(=O)NCCCCCc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5)OCC3Cc3ccc(Cl)cc3)CC2)nn1C |
| InChI | InChI=1S/C41H51ClN6O5/c1-26-21-34(45-46(26)2)28-12-16-32(17-13-28)47-24-36(53-25-33(47)22-27-10-14-31(42)15-11-27)40(51)43-20-5-3-4-7-29-8-6-9-30-23-48(41(52)38(29)30)35-18-19-37(49)44-39(35)50/h6,8-11,14-15,21,28,32-33,35-36H,3-5,7,12-13,16-20,22-25H2,1-2H3,(H,43,51)(H,44,49,50) |
| InChIKey | OERMOJFZHZMFAC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|