C21H14N3OP — CID 170309692
4,5-diphenyl-6-(2-phosphorosophenyl)triazine (PubChem CID 170309692) has the molecular formula C21H14N3OP and a molecular weight of 355.34 g/mol. Its IUPAC name is 4,5-diphenyl-6-(2-phosphorosophenyl)triazine.
| Compound Name | 4,5-diphenyl-6-(2-phosphorosophenyl)triazine |
|---|---|
| PubChem CID | 170309692 |
| Molecular Formula | C21H14N3OP |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4,5-diphenyl-6-(2-phosphorosophenyl)triazine |
| SMILES | O=Pc1ccccc1-c1nnnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H14N3OP/c25-26-18-14-8-7-13-17(18)21-19(15-9-3-1-4-10-15)20(22-24-23-21)16-11-5-2-6-12-16/h1-14H |
| InChIKey | YGYKDUNNIHOEFK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|