C33H44F3N7O4S — CID 170309744
7-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]-2-fluorophenyl]ethylamino]-6-(4-methylsulfonylpiperazin-1-yl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]heptanal (PubChem CID 170309744) has the molecular formula C33H44F3N7O4S and a molecular weight of 691.82 g/mol. Its IUPAC name is 7-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]-2-fluorophenyl]ethylamino]-6-(4-methylsulfonylpiperazin-1-yl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]heptanal.
| Compound Name | 7-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]-2-fluorophenyl]ethylamino]-6-(4-methylsulfonylpiperazin-1-yl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]heptanal |
|---|---|
| PubChem CID | 170309744 |
| Molecular Formula | C33H44F3N7O4S |
| Molecular Weight | 691.82 g/mol |
| Exact Mass | 691.31 |
| IUPAC Name | 7-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]-2-fluorophenyl]ethylamino]-6-(4-methylsulfonylpiperazin-1-yl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]heptanal |
| SMILES | CC(Nc1ncnc2c1cc(N1CCN(S(C)(=O)=O)CC1)c(=O)n2CCCCCCC=O)c1cccc(C(F)(F)C2CCNCC2)c1F |
| InChI | InChI=1S/C33H44F3N7O4S/c1-23(25-9-8-10-27(29(25)34)33(35,36)24-11-13-37-14-12-24)40-30-26-21-28(41-16-18-42(19-17-41)48(2,46)47)32(45)43(31(26)39-22-38-30)15-6-4-3-5-7-20-44/h8-10,20-24,37H,3-7,11-19H2,1-2H3,(H,38,39,40) |
| InChIKey | ATFDWUJWNQDWJT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|