C37H51F2N7O — CID 170308166
4-[2-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethylamino]-8-hex-5-enyl-6-(4-propan-2-ylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 170308166) has the molecular formula C37H51F2N7O and a molecular weight of 647.86 g/mol. Its IUPAC name is 4-[2-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethylamino]-8-hex-5-enyl-6-(4-propan-2-ylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-[2-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethylamino]-8-hex-5-enyl-6-(4-propan-2-ylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 170308166 |
| Molecular Formula | C37H51F2N7O |
| Molecular Weight | 647.86 g/mol |
| Exact Mass | 647.41 |
| IUPAC Name | 4-[2-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethylamino]-8-hex-5-enyl-6-(4-propan-2-ylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CCCCCn1c(=O)c(N2CCN(C(C)C)CC2)cc2c(NCCc3cccc(C(F)(F)C4CCN(CC=C)CC4)c3)ncnc21 |
| InChI | InChI=1S/C37H51F2N7O/c1-5-7-8-9-18-46-35-32(26-33(36(46)47)45-23-21-44(22-24-45)28(3)4)34(41-27-42-35)40-16-13-29-11-10-12-31(25-29)37(38,39)30-14-19-43(17-6-2)20-15-30/h5-6,10-12,25-28,30H,1-2,7-9,13-24H2,3-4H3,(H,40,41,42) |
| InChIKey | XVMBYAIWFWSNFE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.86 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|