C36H47F2N5O3S — CID 169313870
4-[[(1R)-1-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethyl]amino]-6-(1,1-dioxothian-4-yl)-8-hex-5-enyl-2-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 169313870) has the molecular formula C36H47F2N5O3S and a molecular weight of 667.87 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethyl]amino]-6-(1,1-dioxothian-4-yl)-8-hex-5-enyl-2-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-[[(1R)-1-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethyl]amino]-6-(1,1-dioxothian-4-yl)-8-hex-5-enyl-2-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169313870 |
| Molecular Formula | C36H47F2N5O3S |
| Molecular Weight | 667.87 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | 4-[[(1R)-1-[3-[difluoro-(1-prop-2-enylpiperidin-4-yl)methyl]phenyl]ethyl]amino]-6-(1,1-dioxothian-4-yl)-8-hex-5-enyl-2-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CCCCCn1c(=O)c(C2CCS(=O)(=O)CC2)cc2c(N[C@H](C)c3cccc(C(F)(F)C4CCN(CC=C)CC4)c3)nc(C)nc21 |
| InChI | InChI=1S/C36H47F2N5O3S/c1-5-7-8-9-18-43-34-32(24-31(35(43)44)27-15-21-47(45,46)22-16-27)33(40-26(4)41-34)39-25(3)28-11-10-12-30(23-28)36(37,38)29-13-19-42(17-6-2)20-14-29/h5-6,10-12,23-25,27,29H,1-2,7-9,13-22H2,3-4H3,(H,39,40,41)/t25-/m1/s1 |
| InChIKey | IDWOXBSUVBKLAU-RUZDIDTESA-N |
| XLogP | 6.91 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.87 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|