C25H30F2N6O2 — CID 164917238
4-[4-[[(1R)-1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethyl]amino]-7-imino-8-methanimidoyl-2-methylpyrido[2,3-d]pyrimidin-6-yl]cyclohexan-1-ol (PubChem CID 164917238) has the molecular formula C25H30F2N6O2 and a molecular weight of 484.55 g/mol. Its IUPAC name is 4-[4-[[(1R)-1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethyl]amino]-7-imino-8-methanimidoyl-2-methylpyrido[2,3-d]pyrimidin-6-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-[[(1R)-1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethyl]amino]-7-imino-8-methanimidoyl-2-methylpyrido[2,3-d]pyrimidin-6-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 164917238 |
| Molecular Formula | C25H30F2N6O2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 4-[4-[[(1R)-1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethyl]amino]-7-imino-8-methanimidoyl-2-methylpyrido[2,3-d]pyrimidin-6-yl]cyclohexan-1-ol |
| SMILES | [H]/N=c1/c(C2CCC(O)CC2)cc2c(N[C@H](C)c3cccc(C(F)(F)CO)c3)nc(C)nc2n1/C=N/[H] |
| InChI | InChI=1S/C25H30F2N6O2/c1-14(17-4-3-5-18(10-17)25(26,27)12-34)30-23-21-11-20(16-6-8-19(35)9-7-16)22(29)33(13-28)24(21)32-15(2)31-23/h3-5,10-11,13-14,16,19,28-29,34-35H,6-9,12H2,1-2H3,(H,30,31,32)/b28-13+,29-22-/t14-,16?,19?/m1/s1 |
| InChIKey | NDXHAMVHGJIBMX-QYCFUVJJSA-N |
| XLogP | 3.95 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|