C25H28F3N9O2 — CID 176827308
1-[4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-methyl-2,3,4,5,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 176827308) has the molecular formula C25H28F3N9O2 and a molecular weight of 543.55 g/mol. Its IUPAC name is 1-[4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-methyl-2,3,4,5,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-methyl-2,3,4,5,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 176827308 |
| Molecular Formula | C25H28F3N9O2 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-[4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-methyl-2,3,4,5,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(c2cc3c(N[C@H](C)c4cc(N)cc(C(F)(F)F)c4)nc(C)nc3n3nnnc23)CC1 |
| InChI | InChI=1S/C25H28F3N9O2/c1-13(16-8-17(25(26,27)28)10-18(29)9-16)30-22-20-11-19(15-4-6-36(7-5-15)21(38)12-39-3)24-33-34-35-37(24)23(20)32-14(2)31-22/h8-11,13,15H,4-7,12,29H2,1-3H3,(H,30,31,32)/t13-/m1/s1 |
| InChIKey | FJJYSFPVVIBVOQ-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|