C22H30ClNOS — CID 17031
2-(2,2-diphenylacetyl)sulfanylethyl-dipropylazanium chloride (PubChem CID 17031) has the molecular formula C22H30ClNOS and a molecular weight of 392.01 g/mol. Its IUPAC name is 2-(2,2-diphenylacetyl)sulfanylethyl-dipropylazanium chloride.
| Compound Name | 2-(2,2-diphenylacetyl)sulfanylethyl-dipropylazanium chloride |
|---|---|
| PubChem CID | 17031 |
| Molecular Formula | C22H30ClNOS |
| Molecular Weight | 392.01 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-(2,2-diphenylacetyl)sulfanylethyl-dipropylazanium chloride |
| SMILES | CCC[NH+](CCC)CCSC(=O)C(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H29NOS.ClH/c1-3-15-23(16-4-2)17-18-25-22(24)21(19-11-7-5-8-12-19)20-13-9-6-10-14-20;/h5-14,21H,3-4,15-18H2,1-2H3;1H |
| InChIKey | HRAOWFUEZFOQAQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.01 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|