C20H28N4O4 — CID 17031184
2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 17031184) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 17031184 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COCC(=O)NCCCc1nc2ccccc2n1CC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C20H28N4O4/c1-27-14-20(26)21-10-4-9-18-23-16-7-2-3-8-17(16)24(18)13-19(25)22-12-15-6-5-11-28-15/h2-3,7-8,15H,4-6,9-14H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | XQELAECYHPKIGE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|