C14H19IN2O5 — CID 170312328
2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 170312328) has the molecular formula C14H19IN2O5 and a molecular weight of 422.22 g/mol. Its IUPAC name is 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 170312328 |
| Molecular Formula | C14H19IN2O5 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(C(=O)O)co2)CC1I |
| InChI | InChI=1S/C14H19IN2O5/c1-14(2,3)22-13(20)17-5-4-8(6-10(17)15)11-16-9(7-21-11)12(18)19/h7-8,10H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | NESWLNSCERKLQE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|