C15H21IN2O5 — CID 170312323
methyl 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylate (PubChem CID 170312323) has the molecular formula C15H21IN2O5 and a molecular weight of 436.25 g/mol. Its IUPAC name is methyl 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 170312323 |
| Molecular Formula | C15H21IN2O5 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | methyl 2-[2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(C2CCN(C(=O)OC(C)(C)C)C(I)C2)n1 |
| InChI | InChI=1S/C15H21IN2O5/c1-15(2,3)23-14(20)18-6-5-9(7-11(18)16)12-17-10(8-22-12)13(19)21-4/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | OJGPSFIIPGIMLT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|