C17H20FN5 — CID 170313554
4-[4-[(1-ethylpyrazol-4-yl)methyl]piperazin-1-yl]-3-fluorobenzonitrile (PubChem CID 170313554) has the molecular formula C17H20FN5 and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-[4-[(1-ethylpyrazol-4-yl)methyl]piperazin-1-yl]-3-fluorobenzonitrile.
| Compound Name | 4-[4-[(1-ethylpyrazol-4-yl)methyl]piperazin-1-yl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 170313554 |
| Molecular Formula | C17H20FN5 |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[4-[(1-ethylpyrazol-4-yl)methyl]piperazin-1-yl]-3-fluorobenzonitrile |
| SMILES | CCn1cc(CN2CCN(c3ccc(C#N)cc3F)CC2)cn1 |
| InChI | InChI=1S/C17H20FN5/c1-2-23-13-15(11-20-23)12-21-5-7-22(8-6-21)17-4-3-14(10-19)9-16(17)18/h3-4,9,11,13H,2,5-8,12H2,1H3 |
| InChIKey | UFNZCPQGPOOGCX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |