C22H23FN6O — CID 46864918
3-fluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 46864918) has the molecular formula C22H23FN6O and a molecular weight of 406.47 g/mol. Its IUPAC name is 3-fluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 46864918 |
| Molecular Formula | C22H23FN6O |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-fluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(Cc3cnc4c(c3)NC(=O)[C@@H]3CCCN43)CC2)c(F)c1 |
| InChI | InChI=1S/C22H23FN6O/c23-17-10-15(12-24)3-4-19(17)28-8-6-27(7-9-28)14-16-11-18-21(25-13-16)29-5-1-2-20(29)22(30)26-18/h3-4,10-11,13,20H,1-2,5-9,14H2,(H,26,30)/t20-/m0/s1 |
| InChIKey | NAIXRQYFGYHGBG-FQEVSTJZSA-N |
| XLogP | 2.34 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |