C21H23F2N5O — CID 58324446
(6S)-11-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one (PubChem CID 58324446) has the molecular formula C21H23F2N5O and a molecular weight of 399.45 g/mol. Its IUPAC name is (6S)-11-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one.
| Compound Name | (6S)-11-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one |
|---|---|
| PubChem CID | 58324446 |
| Molecular Formula | C21H23F2N5O |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (6S)-11-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one |
| SMILES | O=C1Nc2cc(CN3CCN(c4ccc(F)cc4F)CC3)cnc2N2CCC[C@@H]12 |
| InChI | InChI=1S/C21H23F2N5O/c22-15-3-4-18(16(23)11-15)27-8-6-26(7-9-27)13-14-10-17-20(24-12-14)28-5-1-2-19(28)21(29)25-17/h3-4,10-12,19H,1-2,5-9,13H2,(H,25,29)/t19-/m0/s1 |
| InChIKey | IJUYDXJYENPXCJ-IBGZPJMESA-N |
| XLogP | 2.60 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |