C27H34N6O2 — CID 46864565
N-cyclopropyl-3-methyl-4-[4-[[(10S)-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzamide (PubChem CID 46864565) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-cyclopropyl-3-methyl-4-[4-[[(10S)-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-cyclopropyl-3-methyl-4-[4-[[(10S)-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 46864565 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-cyclopropyl-3-methyl-4-[4-[[(10S)-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzamide |
| SMILES | Cc1cc(C(=O)NC2CC2)ccc1N1CCN(Cc2cnc3c(c2)NC(=O)[C@@H]2CCCCN32)CC1 |
| InChI | InChI=1S/C27H34N6O2/c1-18-14-20(26(34)29-21-6-7-21)5-8-23(18)32-12-10-31(11-13-32)17-19-15-22-25(28-16-19)33-9-3-2-4-24(33)27(35)30-22/h5,8,14-16,21,24H,2-4,6-7,9-13,17H2,1H3,(H,29,34)(H,30,35)/t24-/m0/s1 |
| InChIKey | WOUVFUKBYGEXOZ-DEOSSOPVSA-N |
| XLogP | 2.92 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |