C22H27N7O2 — CID 58324370
N-methyl-6-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 58324370) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is N-methyl-6-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-methyl-6-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58324370 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-methyl-6-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3cnc4c(c3)NC(=O)[C@@H]3CCCN43)CC2)nc1 |
| InChI | InChI=1S/C22H27N7O2/c1-23-21(30)16-4-5-19(24-13-16)28-9-7-27(8-10-28)14-15-11-17-20(25-12-15)29-6-2-3-18(29)22(31)26-17/h4-5,11-13,18H,2-3,6-10,14H2,1H3,(H,23,30)(H,26,31)/t18-/m0/s1 |
| InChIKey | PVBIEGJRECSVFB-SFHVURJKSA-N |
| XLogP | 1.08 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |