C23H27ClN6O2S — CID 76760521
3-chloro-N-methyl-4-[4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzamide (PubChem CID 76760521) has the molecular formula C23H27ClN6O2S and a molecular weight of 487.03 g/mol. Its IUPAC name is 3-chloro-N-methyl-4-[4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzamide.
| Compound Name | 3-chloro-N-methyl-4-[4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 76760521 |
| Molecular Formula | C23H27ClN6O2S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-chloro-N-methyl-4-[4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3cnc4c(c3)NC(=O)C3CSCCN43)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H27ClN6O2S/c1-25-22(31)16-2-3-19(17(24)11-16)29-6-4-28(5-7-29)13-15-10-18-21(26-12-15)30-8-9-33-14-20(30)23(32)27-18/h2-3,10-12,20H,4-9,13-14H2,1H3,(H,25,31)(H,27,32) |
| InChIKey | WIXJAUIJSQETNB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |