C28H32N6O — CID 58324390
(10S)-5-[[4-[4-(4-methyl-2-pyridinyl)phenyl]piperazin-1-yl]methyl]-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one (PubChem CID 58324390) has the molecular formula C28H32N6O and a molecular weight of 468.61 g/mol. Its IUPAC name is (10S)-5-[[4-[4-(4-methyl-2-pyridinyl)phenyl]piperazin-1-yl]methyl]-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one.
| Compound Name | (10S)-5-[[4-[4-(4-methyl-2-pyridinyl)phenyl]piperazin-1-yl]methyl]-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 58324390 |
| Molecular Formula | C28H32N6O |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (10S)-5-[[4-[4-(4-methyl-2-pyridinyl)phenyl]piperazin-1-yl]methyl]-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
| SMILES | Cc1ccnc(-c2ccc(N3CCN(Cc4cnc5c(c4)NC(=O)[C@@H]4CCCCN54)CC3)cc2)c1 |
| InChI | InChI=1S/C28H32N6O/c1-20-9-10-29-24(16-20)22-5-7-23(8-6-22)33-14-12-32(13-15-33)19-21-17-25-27(30-18-21)34-11-3-2-4-26(34)28(35)31-25/h5-10,16-18,26H,2-4,11-15,19H2,1H3,(H,31,35)/t26-/m0/s1 |
| InChIKey | AWKIAHXVBHQHPS-SANMLTNESA-N |
| XLogP | 4.09 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |