C22H22F2N6O — CID 58324427
2,6-difluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 58324427) has the molecular formula C22H22F2N6O and a molecular weight of 424.46 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 58324427 |
| Molecular Formula | C22H22F2N6O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2,6-difluoro-4-[4-[[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1c(F)cc(N2CCN(Cc3cnc4c(c3)NC(=O)[C@@H]3CCCN43)CC2)cc1F |
| InChI | InChI=1S/C22H22F2N6O/c23-17-9-15(10-18(24)16(17)11-25)29-6-4-28(5-7-29)13-14-8-19-21(26-12-14)30-3-1-2-20(30)22(31)27-19/h8-10,12,20H,1-7,13H2,(H,27,31)/t20-/m0/s1 |
| InChIKey | SJVFOPBDZKJRJN-FQEVSTJZSA-N |
| XLogP | 2.47 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |