C17H32N2S — CID 170314188
4-(6-methyldodecan-6-yl)-1,4-thiazin-3-amine (PubChem CID 170314188) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is 4-(6-methyldodecan-6-yl)-1,4-thiazin-3-amine.
| Compound Name | 4-(6-methyldodecan-6-yl)-1,4-thiazin-3-amine |
|---|---|
| PubChem CID | 170314188 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 4-(6-methyldodecan-6-yl)-1,4-thiazin-3-amine |
| SMILES | CCCCCCC(C)(CCCCC)N1C=CSC=C1N |
| InChI | InChI=1S/C17H32N2S/c1-4-6-8-10-12-17(3,11-9-7-5-2)19-13-14-20-15-16(19)18/h13-15H,4-12,18H2,1-3H3 |
| InChIKey | NWYYSFZTCVJUJQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|