C11H15N5O3S — CID 170316255
4-(1-bicyclo[1.1.1]pentanylamino)-2-(methylsulfamoyl)pyrimidine-5-carboxamide (PubChem CID 170316255) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-(1-bicyclo[1.1.1]pentanylamino)-2-(methylsulfamoyl)pyrimidine-5-carboxamide.
| Compound Name | 4-(1-bicyclo[1.1.1]pentanylamino)-2-(methylsulfamoyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 170316255 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-(1-bicyclo[1.1.1]pentanylamino)-2-(methylsulfamoyl)pyrimidine-5-carboxamide |
| SMILES | CNS(=O)(=O)c1ncc(C(N)=O)c(NC23CC(C2)C3)n1 |
| InChI | InChI=1S/C11H15N5O3S/c1-13-20(18,19)10-14-5-7(8(12)17)9(15-10)16-11-2-6(3-11)4-11/h5-6,13H,2-4H2,1H3,(H2,12,17)(H,14,15,16) |
| InChIKey | UUTWHKDPXFQDPP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |