C26H29F3N6O2 — CID 170317405
1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl-[4-[1-[5-amino-3-(difluoromethyl)-2-fluorophenyl]ethylamino]-2-methyl-6-(methylamino)quinazolin-7-yl]methanone (PubChem CID 170317405) has the molecular formula C26H29F3N6O2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl-[4-[1-[5-amino-3-(difluoromethyl)-2-fluorophenyl]ethylamino]-2-methyl-6-(methylamino)quinazolin-7-yl]methanone.
| Compound Name | 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl-[4-[1-[5-amino-3-(difluoromethyl)-2-fluorophenyl]ethylamino]-2-methyl-6-(methylamino)quinazolin-7-yl]methanone |
|---|---|
| PubChem CID | 170317405 |
| Molecular Formula | C26H29F3N6O2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl-[4-[1-[5-amino-3-(difluoromethyl)-2-fluorophenyl]ethylamino]-2-methyl-6-(methylamino)quinazolin-7-yl]methanone |
| SMILES | CNc1cc2c(NC(C)c3cc(N)cc(C(F)F)c3F)nc(C)nc2cc1C(=O)N1CC2COCC2C1 |
| InChI | InChI=1S/C26H29F3N6O2/c1-12(17-4-16(30)5-20(23(17)27)24(28)29)32-25-18-6-21(31-3)19(7-22(18)33-13(2)34-25)26(36)35-8-14-10-37-11-15(14)9-35/h4-7,12,14-15,24,31H,8-11,30H2,1-3H3,(H,32,33,34) |
| InChIKey | SUKAQSWDMZWABS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|