C33H40IN6OP — CID 170317552
N-[[1-(dimethylamino)cyclobutyl]methyl]-2-[[(2R,8S)-2-iodo-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-amine (PubChem CID 170317552) has the molecular formula C33H40IN6OP and a molecular weight of 694.60 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-2-[[(2R,8S)-2-iodo-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-2-[[(2R,8S)-2-iodo-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170317552 |
| Molecular Formula | C33H40IN6OP |
| Molecular Weight | 694.60 g/mol |
| Exact Mass | 694.20 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-2-[[(2R,8S)-2-iodo-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)-8-phosphanylpyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Cc1cccc2cccc(-c3ncc4c(NCC5(N(C)C)CCC5)nc(OC[C@@]56CCCN5C[C@H](I)C6)nc4c3P)c12 |
| InChI | InChI=1S/C33H40IN6OP/c1-21-8-4-9-22-10-5-11-24(26(21)22)27-29(42)28-25(17-35-27)30(36-19-32(39(2)3)12-6-13-32)38-31(37-28)41-20-33-14-7-15-40(33)18-23(34)16-33/h4-5,8-11,17,23H,6-7,12-16,18-20,42H2,1-3H3,(H,36,37,38)/t23-,33+/m1/s1 |
| InChIKey | BQJZAPKCOFGYJK-NHRFMIRVSA-N |
| XLogP | 5.97 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|