C36H41FN6O — CID 170317545
N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-prop-1-ynylnaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 170317545) has the molecular formula C36H41FN6O and a molecular weight of 592.76 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-prop-1-ynylnaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-prop-1-ynylnaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170317545 |
| Molecular Formula | C36H41FN6O |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-prop-1-ynylnaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CC#Cc1cccc2cccc(-c3ncc4c(NCC5(N(C)C)CCC5)nc(OC[C@@]56CCCN5C[C@H](C)C6)nc4c3F)c12 |
| InChI | InChI=1S/C36H41FN6O/c1-5-10-25-11-6-12-26-13-7-14-27(29(25)26)31-30(37)32-28(20-38-31)33(39-22-35(42(3)4)15-8-16-35)41-34(40-32)44-23-36-17-9-18-43(36)21-24(2)19-36/h6-7,11-14,20,24H,8-9,15-19,21-23H2,1-4H3,(H,39,40,41)/t24-,36+/m1/s1 |
| InChIKey | XLPPZCIQAWSJPA-PNBVQZGLSA-N |
| XLogP | 6.50 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|