C35H43ClFN5Si — CID 169305516
2-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 169305516) has the molecular formula C35H43ClFN5Si and a molecular weight of 616.30 g/mol. Its IUPAC name is 2-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 169305516 |
| Molecular Formula | C35H43ClFN5Si |
| Molecular Weight | 616.30 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 2-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]-8-fluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CC(C)[Si](C#Cc1cccc2cccc(-c3ncc4c(NCC5(N(C)C)CCC5)nc(Cl)nc4c3F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H43ClFN5Si/c1-22(2)43(23(3)4,24(5)6)19-16-26-13-9-12-25-14-10-15-27(29(25)26)31-30(37)32-28(20-38-31)33(41-34(36)40-32)39-21-35(42(7)8)17-11-18-35/h9-10,12-15,20,22-24H,11,17-18,21H2,1-8H3,(H,39,40,41) |
| InChIKey | RKMZMPWIBYZTCU-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.30 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|