C34H38ClFN4Si — CID 171752501
2-[8-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]naphthalen-1-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 171752501) has the molecular formula C34H38ClFN4Si and a molecular weight of 585.24 g/mol. Its IUPAC name is 2-[8-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]naphthalen-1-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[8-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]naphthalen-1-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 171752501 |
| Molecular Formula | C34H38ClFN4Si |
| Molecular Weight | 585.24 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 2-[8-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]naphthalen-1-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1cccc2cccc(-c3ncc4c(N5C[C@H]6NCC[C@H]65)c(Cl)cnc4c3F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H38ClFN4Si/c1-20(2)41(21(3)4,22(5)6)16-14-24-10-7-9-23-11-8-12-25(30(23)24)32-31(36)33-26(17-38-32)34(27(35)18-39-33)40-19-28-29(40)13-15-37-28/h7-12,17-18,20-22,28-29,37H,13,15,19H2,1-6H3/t28-,29-/m1/s1 |
| InChIKey | DWBGJOUVNDJBEF-FQLXRVMXSA-N |
| XLogP | 8.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.24 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|