C36H42F2N4O2Si — CID 170939576
8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 170939576) has the molecular formula C36H42F2N4O2Si and a molecular weight of 628.84 g/mol. Its IUPAC name is 8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 170939576 |
| Molecular Formula | C36H42F2N4O2Si |
| Molecular Weight | 628.84 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)[Si](C#Cc1cccc2cccc(-c3ncc4c(=O)[nH]c(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H42F2N4O2Si/c1-22(2)45(23(3)4,24(5)6)17-14-26-11-7-10-25-12-8-13-28(30(25)26)32-31(38)33-29(19-39-32)34(43)41-35(40-33)44-21-36-15-9-16-42(36)20-27(37)18-36/h7-8,10-13,19,22-24,27H,9,15-16,18,20-21H2,1-6H3,(H,40,41,43)/t27-,36+/m1/s1 |
| InChIKey | QXSPYJOGKOWZLT-YHZWMNSLSA-N |
| XLogP | 7.80 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.84 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|