C34H38ClFN4OSi — CID 171752567
4-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol (PubChem CID 171752567) has the molecular formula C34H38ClFN4OSi and a molecular weight of 601.24 g/mol. Its IUPAC name is 4-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol.
| Compound Name | 4-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 171752567 |
| Molecular Formula | C34H38ClFN4OSi |
| Molecular Weight | 601.24 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 4-[3-chloro-4-[(1R,5R)-2,6-diazabicyclo[3.2.0]heptan-6-yl]-8-fluoro-1,6-naphthyridin-7-yl]-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol |
| SMILES | CC(C)[Si](C#Cc1cccc2cc(O)cc(-c3ncc4c(N5C[C@H]6NCC[C@H]65)c(Cl)cnc4c3F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H38ClFN4OSi/c1-19(2)42(20(3)4,21(5)6)13-11-22-8-7-9-23-14-24(41)15-25(30(22)23)32-31(36)33-26(16-38-32)34(27(35)17-39-33)40-18-28-29(40)10-12-37-28/h7-9,14-17,19-21,28-29,37,41H,10,12,18H2,1-6H3/t28-,29-/m1/s1 |
| InChIKey | KJZHRYNUMNSXHT-FQLXRVMXSA-N |
| XLogP | 8.07 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.24 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|