C26H30F3N5O3S2 — CID 170317574
N-[2-ethyl-4-[(3R)-3-methylpiperazin-1-yl]phenyl]-4-(5-methyl-1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 170317574) has the molecular formula C26H30F3N5O3S2 and a molecular weight of 581.69 g/mol. Its IUPAC name is N-[2-ethyl-4-[(3R)-3-methylpiperazin-1-yl]phenyl]-4-(5-methyl-1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[2-ethyl-4-[(3R)-3-methylpiperazin-1-yl]phenyl]-4-(5-methyl-1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170317574 |
| Molecular Formula | C26H30F3N5O3S2 |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | N-[2-ethyl-4-[(3R)-3-methylpiperazin-1-yl]phenyl]-4-(5-methyl-1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCc1cc(N2CCN[C@H](C)C2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(C)OCCS3(=O)=O)n1 |
| InChI | InChI=1S/C26H30F3N5O3S2/c1-4-17-11-18(34-8-7-30-15(2)14-34)5-6-20(17)32-25-31-13-19(26(27,28)29)23(33-25)21-12-22-24(38-21)16(3)37-9-10-39(22,35)36/h5-6,11-13,15-16,30H,4,7-10,14H2,1-3H3,(H,31,32,33)/t15-,16?/m1/s1 |
| InChIKey | XRZRPKKCYDCDBN-AAFJCEBUSA-N |
| XLogP | 5.19 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|