C17H8F5N — CID 170319859
6-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline (PubChem CID 170319859) has the molecular formula C17H8F5N and a molecular weight of 321.25 g/mol. Its IUPAC name is 6-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline.
| Compound Name | 6-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline |
|---|---|
| PubChem CID | 170319859 |
| Molecular Formula | C17H8F5N |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 6-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinoline |
| SMILES | Fc1c(F)c(F)c(C=Cc2ccc3ncccc3c2)c(F)c1F |
| InChI | InChI=1S/C17H8F5N/c18-13-11(14(19)16(21)17(22)15(13)20)5-3-9-4-6-12-10(8-9)2-1-7-23-12/h1-8H |
| InChIKey | DXOUPSASBGWCJT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|