C16H17N3O2 — CID 170324606
methyl 4-(5,6,7,8-tetrahydro-2,6-naphthyridin-3-ylamino)benzoate (PubChem CID 170324606) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 4-(5,6,7,8-tetrahydro-2,6-naphthyridin-3-ylamino)benzoate.
| Compound Name | methyl 4-(5,6,7,8-tetrahydro-2,6-naphthyridin-3-ylamino)benzoate |
|---|---|
| PubChem CID | 170324606 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | methyl 4-(5,6,7,8-tetrahydro-2,6-naphthyridin-3-ylamino)benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc3c(cn2)CCNC3)cc1 |
| InChI | InChI=1S/C16H17N3O2/c1-21-16(20)11-2-4-14(5-3-11)19-15-8-13-9-17-7-6-12(13)10-18-15/h2-5,8,10,17H,6-7,9H2,1H3,(H,18,19) |
| InChIKey | XLEUEFXHOUGZCA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |