C40H42ClN3O6 — CID 170329954
4-[4-[(R)-[2-(4-chlorophenyl)-5-[[4-(4-ethoxycarbonylpiperidin-1-yl)phenyl]carbamoyl]phenyl]-hydroxymethyl]piperidin-1-yl]benzoic acid (PubChem CID 170329954) has the molecular formula C40H42ClN3O6 and a molecular weight of 696.24 g/mol. Its IUPAC name is 4-[4-[(R)-[2-(4-chlorophenyl)-5-[[4-(4-ethoxycarbonylpiperidin-1-yl)phenyl]carbamoyl]phenyl]-hydroxymethyl]piperidin-1-yl]benzoic acid.
| Compound Name | 4-[4-[(R)-[2-(4-chlorophenyl)-5-[[4-(4-ethoxycarbonylpiperidin-1-yl)phenyl]carbamoyl]phenyl]-hydroxymethyl]piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 170329954 |
| Molecular Formula | C40H42ClN3O6 |
| Molecular Weight | 696.24 g/mol |
| Exact Mass | 695.28 |
| IUPAC Name | 4-[4-[(R)-[2-(4-chlorophenyl)-5-[[4-(4-ethoxycarbonylpiperidin-1-yl)phenyl]carbamoyl]phenyl]-hydroxymethyl]piperidin-1-yl]benzoic acid |
| SMILES | CCOC(=O)C1CCN(c2ccc(NC(=O)c3ccc(-c4ccc(Cl)cc4)c([C@H](O)C4CCN(c5ccc(C(=O)O)cc5)CC4)c3)cc2)CC1 |
| InChI | InChI=1S/C40H42ClN3O6/c1-2-50-40(49)29-19-23-44(24-20-29)34-14-10-32(11-15-34)42-38(46)30-7-16-35(26-3-8-31(41)9-4-26)36(25-30)37(45)27-17-21-43(22-18-27)33-12-5-28(6-13-33)39(47)48/h3-16,25,27,29,37,45H,2,17-24H2,1H3,(H,42,46)(H,47,48)/t37-/m1/s1 |
| InChIKey | DJUOHNDCVCUCQT-DIPNUNPCSA-N |
| XLogP | 7.69 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.24 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|