C28H27ClN2O2 — CID 58080141
ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]-isocyanomethyl]piperidin-1-yl]benzoate (PubChem CID 58080141) has the molecular formula C28H27ClN2O2 and a molecular weight of 458.99 g/mol. Its IUPAC name is ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]-isocyanomethyl]piperidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]-isocyanomethyl]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 58080141 |
| Molecular Formula | C28H27ClN2O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]-isocyanomethyl]piperidin-1-yl]benzoate |
| SMILES | [C-]#[N+]C(c1ccccc1-c1ccc(Cl)cc1)C1CCN(c2ccc(C(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C28H27ClN2O2/c1-3-33-28(32)22-10-14-24(15-11-22)31-18-16-21(17-19-31)27(30-2)26-7-5-4-6-25(26)20-8-12-23(29)13-9-20/h4-15,21,27H,3,16-19H2,1H3 |
| InChIKey | KDVNPHIYGIELRQ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|