C27H28ClN2O2- — CID 131732793
4-[4-[(R)-[2-(4-chlorophenyl)phenyl]-(dimethylamino)methyl]piperidin-1-yl]benzoate (PubChem CID 131732793) has the molecular formula C27H28ClN2O2- and a molecular weight of 447.99 g/mol. Its IUPAC name is 4-[4-[(R)-[2-(4-chlorophenyl)phenyl]-(dimethylamino)methyl]piperidin-1-yl]benzoate.
| Compound Name | 4-[4-[(R)-[2-(4-chlorophenyl)phenyl]-(dimethylamino)methyl]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 131732793 |
| Molecular Formula | C27H28ClN2O2- |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[4-[(R)-[2-(4-chlorophenyl)phenyl]-(dimethylamino)methyl]piperidin-1-yl]benzoate |
| SMILES | CN(C)[C@@H](c1ccccc1-c1ccc(Cl)cc1)C1CCN(c2ccc(C(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C27H29ClN2O2/c1-29(2)26(25-6-4-3-5-24(25)19-7-11-22(28)12-8-19)20-15-17-30(18-16-20)23-13-9-21(10-14-23)27(31)32/h3-14,20,26H,15-18H2,1-2H3,(H,31,32)/p-1/t26-/m1/s1 |
| InChIKey | HOKVMYPNHZTQFR-AREMUKBSSA-M |
| XLogP | 4.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |