C28H31ClN2O2 — CID 71025280
ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]methyl-methylamino]piperidin-1-yl]benzoate (PubChem CID 71025280) has the molecular formula C28H31ClN2O2 and a molecular weight of 463.02 g/mol. Its IUPAC name is ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]methyl-methylamino]piperidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]methyl-methylamino]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 71025280 |
| Molecular Formula | C28H31ClN2O2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | ethyl 4-[4-[[2-(4-chlorophenyl)phenyl]methyl-methylamino]piperidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCC(N(C)Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H31ClN2O2/c1-3-33-28(32)22-10-14-26(15-11-22)31-18-16-25(17-19-31)30(2)20-23-6-4-5-7-27(23)21-8-12-24(29)13-9-21/h4-15,25H,3,16-20H2,1-2H3 |
| InChIKey | KSBVKGMPQWUFJD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |