C28H35ClN2O2 — CID 25140338
ethyl 4-[4-[[(1Z)-2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzoate (PubChem CID 25140338) has the molecular formula C28H35ClN2O2 and a molecular weight of 467.05 g/mol. Its IUPAC name is ethyl 4-[4-[[(1Z)-2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[(1Z)-2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 25140338 |
| Molecular Formula | C28H35ClN2O2 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | ethyl 4-[4-[[(1Z)-2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C/C3=C(\c4ccc(Cl)cc4)CCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C28H35ClN2O2/c1-2-33-28(32)23-11-15-26(16-12-23)31-19-17-30(18-20-31)21-24-7-5-3-4-6-8-27(24)22-9-13-25(29)14-10-22/h9-16H,2-8,17-21H2,1H3/b27-24- |
| InChIKey | HBVSJQAKRPVUIN-PNHLSOANSA-N |
| XLogP | 6.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |