C26H31ClN2O — CID 91118740
4-[4-[[2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzaldehyde (PubChem CID 91118740) has the molecular formula C26H31ClN2O and a molecular weight of 423.00 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzaldehyde.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 91118740 |
| Molecular Formula | C26H31ClN2O |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)cycloocten-1-yl]methyl]piperazin-1-yl]benzaldehyde |
| SMILES | O=Cc1ccc(N2CCN(CC3=C(c4ccc(Cl)cc4)CCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H31ClN2O/c27-24-11-9-22(10-12-24)26-6-4-2-1-3-5-23(26)19-28-15-17-29(18-16-28)25-13-7-21(20-30)8-14-25/h7-14,20H,1-6,15-19H2 |
| InChIKey | IZDDACJEBMHUMO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|