C13H11N3O2S3 — CID 17033492
[4-[[2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]phenyl] thiocyanate (PubChem CID 17033492) has the molecular formula C13H11N3O2S3 and a molecular weight of 337.45 g/mol. Its IUPAC name is [4-[[2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 17033492 |
| Molecular Formula | C13H11N3O2S3 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | [4-[[2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]phenyl] thiocyanate |
| SMILES | CC1SC(=S)N(CC(=O)Nc2ccc(SC#N)cc2)C1=O |
| InChI | InChI=1S/C13H11N3O2S3/c1-8-12(18)16(13(19)21-8)6-11(17)15-9-2-4-10(5-3-9)20-7-14/h2-5,8H,6H2,1H3,(H,15,17) |
| InChIKey | GECWWXZFUTXDMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|