C15H27BrN2O2 — CID 170335086
(3S,5R)-4-[[4-(bromomethyl)cyclohexyl]methyl]-3,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 170335086) has the molecular formula C15H27BrN2O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is (3S,5R)-4-[[4-(bromomethyl)cyclohexyl]methyl]-3,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (3S,5R)-4-[[4-(bromomethyl)cyclohexyl]methyl]-3,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170335086 |
| Molecular Formula | C15H27BrN2O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3S,5R)-4-[[4-(bromomethyl)cyclohexyl]methyl]-3,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)C[C@H](C)N1CC1CCC(CBr)CC1 |
| InChI | InChI=1S/C15H27BrN2O2/c1-11-8-17(15(19)20)9-12(2)18(11)10-14-5-3-13(7-16)4-6-14/h11-14H,3-10H2,1-2H3,(H,19,20)/t11-,12+,13?,14? |
| InChIKey | DXIRJMLKCGOIAB-VTXSZYRJSA-N |
| XLogP | 3.26 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|