C37H32FO3P — CID 170335436
[4-[5-(3,4-dimethoxyphenyl)-10-fluoro-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]phosphane (PubChem CID 170335436) has the molecular formula C37H32FO3P and a molecular weight of 574.63 g/mol. Its IUPAC name is [4-[5-(3,4-dimethoxyphenyl)-10-fluoro-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]phosphane.
| Compound Name | [4-[5-(3,4-dimethoxyphenyl)-10-fluoro-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 170335436 |
| Molecular Formula | C37H32FO3P |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [4-[5-(3,4-dimethoxyphenyl)-10-fluoro-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]phosphane |
| SMILES | COc1ccc(C2(c3ccc(P)cc3)C=Cc3c4c(c5ccc(F)cc5c3O2)-c2ccc(C)cc2C4(C)C)cc1OC |
| InChI | InChI=1S/C37H32FO3P/c1-21-6-13-27-30(18-21)36(2,3)34-28-16-17-37(22-7-11-25(42)12-8-22,23-9-15-31(39-4)32(19-23)40-5)41-35(28)29-20-24(38)10-14-26(29)33(27)34/h6-20H,42H2,1-5H3 |
| InChIKey | FNWPGNFCLCITKZ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|