C22H22NO2+ — CID 170335598
benzyl 1,5-dimethyl-2-(2-methylphenyl)pyridin-1-ium-4-carboxylate (PubChem CID 170335598) has the molecular formula C22H22NO2+ and a molecular weight of 332.42 g/mol. Its IUPAC name is benzyl 1,5-dimethyl-2-(2-methylphenyl)pyridin-1-ium-4-carboxylate.
| Compound Name | benzyl 1,5-dimethyl-2-(2-methylphenyl)pyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 170335598 |
| Molecular Formula | C22H22NO2+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | benzyl 1,5-dimethyl-2-(2-methylphenyl)pyridin-1-ium-4-carboxylate |
| SMILES | Cc1c[n+](C)c(-c2ccccc2C)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22NO2/c1-16-9-7-8-12-19(16)21-13-20(17(2)14-23(21)3)22(24)25-15-18-10-5-4-6-11-18/h4-14H,15H2,1-3H3/q+1 |
| InChIKey | CQTYMDUUZFLNSR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|