C13H10ClN3O — CID 170335782
5-chloro-N-(pyridin-4-ylmethyl)furo[3,2-b]pyridin-7-amine (PubChem CID 170335782) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is 5-chloro-N-(pyridin-4-ylmethyl)furo[3,2-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-(pyridin-4-ylmethyl)furo[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170335782 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-chloro-N-(pyridin-4-ylmethyl)furo[3,2-b]pyridin-7-amine |
| SMILES | Clc1cc(NCc2ccncc2)c2occc2n1 |
| InChI | InChI=1S/C13H10ClN3O/c14-12-7-11(13-10(17-12)3-6-18-13)16-8-9-1-4-15-5-2-9/h1-7H,8H2,(H,16,17) |
| InChIKey | GAYZCWIEKRKVNT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|