C19H15N3O — CID 118486383
5-phenyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyridin-7-amine (PubChem CID 118486383) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-phenyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyridin-7-amine.
| Compound Name | 5-phenyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 118486383 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-phenyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyridin-7-amine |
| SMILES | c1ccc(-c2cc(NCc3cccnc3)c3occc3n2)cc1 |
| InChI | InChI=1S/C19H15N3O/c1-2-6-15(7-3-1)17-11-18(19-16(22-17)8-10-23-19)21-13-14-5-4-9-20-12-14/h1-12H,13H2,(H,21,22) |
| InChIKey | XFYIAINDVWDJDA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |